C26H21N3O4S — CID 133183321
methyl 2-[5-[3-(2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate (PubChem CID 133183321) has the molecular formula C26H21N3O4S and a molecular weight of 471.54 g/mol. Its IUPAC name is methyl 2-[5-[3-(2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[3-(2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 133183321 |
| Molecular Formula | C26H21N3O4S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | methyl 2-[5-[3-(2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(C2C(c3ccccn3)NC(=S)N2c2ccccc2O)o1 |
| InChI | InChI=1S/C26H21N3O4S/c1-32-25(31)17-9-3-2-8-16(17)21-13-14-22(33-21)24-23(18-10-6-7-15-27-18)28-26(34)29(24)19-11-4-5-12-20(19)30/h2-15,23-24,30H,1H3,(H,28,34) |
| InChIKey | OIFKJERZTUNRHU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|