C26H20FN3O3S — CID 133182492
methyl 4-[5-[3-(2-fluorophenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate (PubChem CID 133182492) has the molecular formula C26H20FN3O3S and a molecular weight of 473.53 g/mol. Its IUPAC name is methyl 4-[5-[3-(2-fluorophenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[3-(2-fluorophenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 133182492 |
| Molecular Formula | C26H20FN3O3S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | methyl 4-[5-[3-(2-fluorophenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3ccccc3F)o2)cc1 |
| InChI | InChI=1S/C26H20FN3O3S/c1-32-25(31)17-11-9-16(10-12-17)21-13-14-22(33-21)24-23(19-7-4-5-15-28-19)29-26(34)30(24)20-8-3-2-6-18(20)27/h2-15,23-24H,1H3,(H,29,34) |
| InChIKey | MCBFBYKGSXQFJK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|