C28H25N3O5S — CID 133223939
methyl 4-[5-[3-(2,5-dimethoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate (PubChem CID 133223939) has the molecular formula C28H25N3O5S and a molecular weight of 515.59 g/mol. Its IUPAC name is methyl 4-[5-[3-(2,5-dimethoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[3-(2,5-dimethoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 133223939 |
| Molecular Formula | C28H25N3O5S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | methyl 4-[5-[3-(2,5-dimethoxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3cc(OC)ccc3OC)o2)cc1 |
| InChI | InChI=1S/C28H25N3O5S/c1-33-19-11-12-23(34-2)21(16-19)31-26(25(30-28(31)37)20-6-4-5-15-29-20)24-14-13-22(36-24)17-7-9-18(10-8-17)27(32)35-3/h4-16,25-26H,1-3H3,(H,30,37) |
| InChIKey | FKSIKZJPWGKCAD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|