C26H20ClN3O4S — CID 133224103
methyl 3-[5-[3-(5-chloro-2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate (PubChem CID 133224103) has the molecular formula C26H20ClN3O4S and a molecular weight of 505.98 g/mol. Its IUPAC name is methyl 3-[5-[3-(5-chloro-2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate.
| Compound Name | methyl 3-[5-[3-(5-chloro-2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 133224103 |
| Molecular Formula | C26H20ClN3O4S |
| Molecular Weight | 505.98 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | methyl 3-[5-[3-(5-chloro-2-hydroxyphenyl)-5-pyridin-2-yl-2-sulfanylideneimidazolidin-4-yl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(C3C(c4ccccn4)NC(=S)N3c3cc(Cl)ccc3O)o2)c1 |
| InChI | InChI=1S/C26H20ClN3O4S/c1-33-25(32)16-6-4-5-15(13-16)21-10-11-22(34-21)24-23(18-7-2-3-12-28-18)29-26(35)30(24)19-14-17(27)8-9-20(19)31/h2-14,23-24,31H,1H3,(H,29,35) |
| InChIKey | GIHJIOQBWCLBJQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.98 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|