C24H17Cl2N3O2S2 — CID 133224062
1-(5-chloro-2-hydroxyphenyl)-5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133224062) has the molecular formula C24H17Cl2N3O2S2 and a molecular weight of 514.46 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133224062 |
| Molecular Formula | C24H17Cl2N3O2S2 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Oc1ccc(Cl)cc1N1C(=S)NC(c2ccccn2)C1c1ccc(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C24H17Cl2N3O2S2/c25-14-4-7-16(8-5-14)33-21-11-10-20(31-21)23-22(17-3-1-2-12-27-17)28-24(32)29(23)18-13-15(26)6-9-19(18)30/h1-13,22-23,30H,(H,28,32) |
| InChIKey | QLEFHFSCYZSFLP-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|