C25H20ClN3O2S2 — CID 133183116
5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183116) has the molecular formula C25H20ClN3O2S2 and a molecular weight of 494.04 g/mol. Its IUPAC name is 5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183116 |
| Molecular Formula | C25H20ClN3O2S2 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-1-(2-methoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccccc1N1C(=S)NC(c2ccccn2)C1c1ccc(Sc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C25H20ClN3O2S2/c1-30-20-8-3-2-7-19(20)29-24(23(28-25(29)32)18-6-4-5-15-27-18)21-13-14-22(31-21)33-17-11-9-16(26)10-12-17/h2-15,23-24H,1H3,(H,28,32) |
| InChIKey | HMLTYJUNLKFFTM-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|