C26H22ClN3O2S2 — CID 133181313
5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-1-[(4-methoxyphenyl)methyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133181313) has the molecular formula C26H22ClN3O2S2 and a molecular weight of 508.07 g/mol. Its IUPAC name is 5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-1-[(4-methoxyphenyl)methyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-1-[(4-methoxyphenyl)methyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133181313 |
| Molecular Formula | C26H22ClN3O2S2 |
| Molecular Weight | 508.07 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 5-[5-(4-chlorophenyl)sulfanylfuran-2-yl]-1-[(4-methoxyphenyl)methyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(CN2C(=S)NC(c3ccccn3)C2c2ccc(Sc3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C26H22ClN3O2S2/c1-31-19-9-5-17(6-10-19)16-30-25(24(29-26(30)33)21-4-2-3-15-28-21)22-13-14-23(32-22)34-20-11-7-18(27)8-12-20/h2-15,24-25H,16H2,1H3,(H,29,33) |
| InChIKey | QOTKTQRAPAWARD-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.07 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|