C20H19N3OS2 — CID 133181185
1-[(4-methoxyphenyl)methyl]-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione (PubChem CID 133181185) has the molecular formula C20H19N3OS2 and a molecular weight of 381.53 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133181185 |
| Molecular Formula | C20H19N3OS2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-4-pyridin-2-yl-5-thiophen-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(CN2C(=S)NC(c3ccccn3)C2c2cccs2)cc1 |
| InChI | InChI=1S/C20H19N3OS2/c1-24-15-9-7-14(8-10-15)13-23-19(17-6-4-12-26-17)18(22-20(23)25)16-5-2-3-11-21-16/h2-12,18-19H,13H2,1H3,(H,22,25) |
| InChIKey | FFXMFWGJIUPBFM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|