C18H16N4S2 — CID 133181528
4-pyridin-2-yl-1-(pyridin-4-ylmethyl)-5-thiophen-2-ylimidazolidine-2-thione (PubChem CID 133181528) has the molecular formula C18H16N4S2 and a molecular weight of 352.49 g/mol. Its IUPAC name is 4-pyridin-2-yl-1-(pyridin-4-ylmethyl)-5-thiophen-2-ylimidazolidine-2-thione.
| Compound Name | 4-pyridin-2-yl-1-(pyridin-4-ylmethyl)-5-thiophen-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133181528 |
| Molecular Formula | C18H16N4S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 4-pyridin-2-yl-1-(pyridin-4-ylmethyl)-5-thiophen-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2cccs2)N1Cc1ccncc1 |
| InChI | InChI=1S/C18H16N4S2/c23-18-21-16(14-4-1-2-8-20-14)17(15-5-3-11-24-15)22(18)12-13-6-9-19-10-7-13/h1-11,16-17H,12H2,(H,21,23) |
| InChIKey | KVRSAUAFGMNYJC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|