C19H18N4S2 — CID 133181162
5-(5-methylthiophen-2-yl)-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)imidazolidine-2-thione (PubChem CID 133181162) has the molecular formula C19H18N4S2 and a molecular weight of 366.52 g/mol. Its IUPAC name is 5-(5-methylthiophen-2-yl)-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)imidazolidine-2-thione.
| Compound Name | 5-(5-methylthiophen-2-yl)-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 133181162 |
| Molecular Formula | C19H18N4S2 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 5-(5-methylthiophen-2-yl)-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)imidazolidine-2-thione |
| SMILES | Cc1ccc(C2C(c3ccccn3)NC(=S)N2Cc2cccnc2)s1 |
| InChI | InChI=1S/C19H18N4S2/c1-13-7-8-16(25-13)18-17(15-6-2-3-10-21-15)22-19(24)23(18)12-14-5-4-9-20-11-14/h2-11,17-18H,12H2,1H3,(H,22,24) |
| InChIKey | DGTFUGSQDHYLOU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|