C27H29N5S — CID 125079407
(4R,5S)-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione (PubChem CID 125079407) has the molecular formula C27H29N5S and a molecular weight of 455.63 g/mol. Its IUPAC name is (4R,5S)-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione.
| Compound Name | (4R,5S)-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 125079407 |
| Molecular Formula | C27H29N5S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (4R,5S)-4-pyridin-2-yl-1-(pyridin-3-ylmethyl)-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione |
| SMILES | CC1=CC(C)(C)N(C)c2ccc([C@H]3[C@H](c4ccccn4)NC(=S)N3Cc3cccnc3)cc21 |
| InChI | InChI=1S/C27H29N5S/c1-18-15-27(2,3)31(4)23-11-10-20(14-21(18)23)25-24(22-9-5-6-13-29-22)30-26(33)32(25)17-19-8-7-12-28-16-19/h5-16,24-25H,17H2,1-4H3,(H,30,33)/t24-,25-/m0/s1 |
| InChIKey | NRJFYISLYALMEH-DQEYMECFSA-N |
| XLogP | 5.28 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|