C32H37N5OS — CID 100672478
N-(2-ethylphenyl)-3-[(4R,5S)-4-pyridin-2-yl-2-sulfanylidene-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidin-1-yl]propanamide (PubChem CID 100672478) has the molecular formula C32H37N5OS and a molecular weight of 539.75 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-[(4R,5S)-4-pyridin-2-yl-2-sulfanylidene-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidin-1-yl]propanamide.
| Compound Name | N-(2-ethylphenyl)-3-[(4R,5S)-4-pyridin-2-yl-2-sulfanylidene-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100672478 |
| Molecular Formula | C32H37N5OS |
| Molecular Weight | 539.75 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | N-(2-ethylphenyl)-3-[(4R,5S)-4-pyridin-2-yl-2-sulfanylidene-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidin-1-yl]propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)N[C@@H](c2ccccn2)[C@@H]1c1ccc2c(c1)C(C)=CC(C)(C)N2C |
| InChI | InChI=1S/C32H37N5OS/c1-6-22-11-7-8-12-25(22)34-28(38)16-18-37-30(29(35-31(37)39)26-13-9-10-17-33-26)23-14-15-27-24(19-23)21(2)20-32(3,4)36(27)5/h7-15,17,19-20,29-30H,6,16,18H2,1-5H3,(H,34,38)(H,35,39)/t29-,30-/m0/s1 |
| InChIKey | SIWOSEMTWJWQOT-KYJUHHDHSA-N |
| XLogP | 6.28 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.75 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|