C33H37N5OS — CID 100674419
N-(2-ethylphenyl)-3-[(4S,5R)-5-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100674419) has the molecular formula C33H37N5OS and a molecular weight of 551.76 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-[(4S,5R)-5-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-ethylphenyl)-3-[(4S,5R)-5-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100674419 |
| Molecular Formula | C33H37N5OS |
| Molecular Weight | 551.76 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | N-(2-ethylphenyl)-3-[(4S,5R)-5-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)N[C@H](c2ccccn2)[C@H]1c1cc(C)n(-c2ccccc2CC)c1C |
| InChI | InChI=1S/C33H37N5OS/c1-5-24-13-7-9-15-27(24)35-30(39)18-20-37-32(31(36-33(37)40)28-16-11-12-19-34-28)26-21-22(3)38(23(26)4)29-17-10-8-14-25(29)6-2/h7-17,19,21,31-32H,5-6,18,20H2,1-4H3,(H,35,39)(H,36,40)/t31-,32-/m1/s1 |
| InChIKey | SXHHBWKNTYOUQZ-ROJLCIKYSA-N |
| XLogP | 6.62 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.76 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|