C33H37N5OS — CID 133218411
3-[5-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide (PubChem CID 133218411) has the molecular formula C33H37N5OS and a molecular weight of 551.76 g/mol. Its IUPAC name is 3-[5-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide.
| Compound Name | 3-[5-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 133218411 |
| Molecular Formula | C33H37N5OS |
| Molecular Weight | 551.76 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | 3-[5-[1-(2,6-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2c(C)cccc2C)c1C |
| InChI | InChI=1S/C33H37N5OS/c1-6-25-14-7-8-15-27(25)35-29(39)17-19-37-32(30(36-33(37)40)28-16-9-10-18-34-28)26-20-23(4)38(24(26)5)31-21(2)12-11-13-22(31)3/h7-16,18,20,30,32H,6,17,19H2,1-5H3,(H,35,39)(H,36,40) |
| InChIKey | OBHPNCQUCPEZSQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.76 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|