C31H31Cl2N5OS — CID 100675423
3-[(4S,5R)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide (PubChem CID 100675423) has the molecular formula C31H31Cl2N5OS and a molecular weight of 592.60 g/mol. Its IUPAC name is 3-[(4S,5R)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide.
| Compound Name | 3-[(4S,5R)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 100675423 |
| Molecular Formula | C31H31Cl2N5OS |
| Molecular Weight | 592.60 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 3-[(4S,5R)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-ethylphenyl)propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)N[C@H](c2ccccn2)[C@H]1c1cc(C)n(-c2cccc(Cl)c2Cl)c1C |
| InChI | InChI=1S/C31H31Cl2N5OS/c1-4-21-10-5-6-12-24(21)35-27(39)15-17-37-30(29(36-31(37)40)25-13-7-8-16-34-25)22-18-19(2)38(20(22)3)26-14-9-11-23(32)28(26)33/h5-14,16,18,29-30H,4,15,17H2,1-3H3,(H,35,39)(H,36,40)/t29-,30-/m1/s1 |
| InChIKey | MWDXYGIAPSAXRK-LOYHVIPDSA-N |
| XLogP | 7.36 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|