C29H26Cl2FN5OS — CID 100698237
3-[(4R,5R)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide (PubChem CID 100698237) has the molecular formula C29H26Cl2FN5OS and a molecular weight of 582.53 g/mol. Its IUPAC name is 3-[(4R,5R)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide.
| Compound Name | 3-[(4R,5R)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 100698237 |
| Molecular Formula | C29H26Cl2FN5OS |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 581.12 |
| IUPAC Name | 3-[(4R,5R)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide |
| SMILES | Cc1cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2CCC(=O)Nc2ccccc2F)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C29H26Cl2FN5OS/c1-17-16-19(18(2)37(17)24-12-7-8-20(30)26(24)31)28-27(23-11-5-6-14-33-23)35-29(39)36(28)15-13-25(38)34-22-10-4-3-9-21(22)32/h3-12,14,16,27-28H,13,15H2,1-2H3,(H,34,38)(H,35,39)/t27-,28+/m0/s1 |
| InChIKey | XYTUQJBGGHBICL-WUFINQPMSA-N |
| XLogP | 6.94 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|