C29H27F2N5OS — CID 133208968
N-(2-fluorophenyl)-3-[5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 133208968) has the molecular formula C29H27F2N5OS and a molecular weight of 531.63 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 133208968 |
| Molecular Formula | C29H27F2N5OS |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | N-(2-fluorophenyl)-3-[5-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2CCC(=O)Nc2ccccc2F)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C29H27F2N5OS/c1-18-17-20(19(2)36(18)25-13-6-4-10-22(25)31)28-27(24-12-7-8-15-32-24)34-29(38)35(28)16-14-26(37)33-23-11-5-3-9-21(23)30/h3-13,15,17,27-28H,14,16H2,1-2H3,(H,33,37)(H,34,38) |
| InChIKey | UASWHIVDWBEJAX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|