C31H32FN5OS — CID 100697292
3-[(4S,5S)-5-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide (PubChem CID 100697292) has the molecular formula C31H32FN5OS and a molecular weight of 541.70 g/mol. Its IUPAC name is 3-[(4S,5S)-5-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide.
| Compound Name | 3-[(4S,5S)-5-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 100697292 |
| Molecular Formula | C31H32FN5OS |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 3-[(4S,5S)-5-[1-(2-ethylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(2-fluorophenyl)propanamide |
| SMILES | CCc1ccccc1-n1c(C)cc([C@H]2[C@@H](c3ccccn3)NC(=S)N2CCC(=O)Nc2ccccc2F)c1C |
| InChI | InChI=1S/C31H32FN5OS/c1-4-22-11-5-8-15-27(22)37-20(2)19-23(21(37)3)30-29(26-14-9-10-17-33-26)35-31(39)36(30)18-16-28(38)34-25-13-7-6-12-24(25)32/h5-15,17,19,29-30H,4,16,18H2,1-3H3,(H,34,38)(H,35,39)/t29-,30+/m1/s1 |
| InChIKey | QYATUNZZLPXUER-IHLOFXLRSA-N |
| XLogP | 6.19 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|