C32H35N5O2S — CID 100675043
N-(2-ethylphenyl)-3-[(4R,5S)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100675043) has the molecular formula C32H35N5O2S and a molecular weight of 553.73 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-[(4R,5S)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-ethylphenyl)-3-[(4R,5S)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100675043 |
| Molecular Formula | C32H35N5O2S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | N-(2-ethylphenyl)-3-[(4R,5S)-5-[1-(3-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | CCc1ccccc1NC(=O)CCN1C(=S)N[C@@H](c2ccccn2)[C@@H]1c1cc(C)n(-c2cccc(OC)c2)c1C |
| InChI | InChI=1S/C32H35N5O2S/c1-5-23-11-6-7-14-27(23)34-29(38)16-18-36-31(30(35-32(36)40)28-15-8-9-17-33-28)26-19-21(2)37(22(26)3)24-12-10-13-25(20-24)39-4/h6-15,17,19-20,30-31H,5,16,18H2,1-4H3,(H,34,38)(H,35,40)/t30-,31-/m0/s1 |
| InChIKey | SIUCWLGJXCNRMX-CONSDPRKSA-N |
| XLogP | 6.06 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|