C29H32N4OS — CID 133181201
1-[(4-methoxyphenyl)methyl]-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione (PubChem CID 133181201) has the molecular formula C29H32N4OS and a molecular weight of 484.67 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 133181201 |
| Molecular Formula | C29H32N4OS |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione |
| SMILES | COc1ccc(CN2C(=S)NC(c3ccccn3)C2c2ccc3c(c2)C(C)=CC(C)(C)N3C)cc1 |
| InChI | InChI=1S/C29H32N4OS/c1-19-17-29(2,3)32(4)25-14-11-21(16-23(19)25)27-26(24-8-6-7-15-30-24)31-28(35)33(27)18-20-9-12-22(34-5)13-10-20/h6-17,26-27H,18H2,1-5H3,(H,31,35) |
| InChIKey | QODLJJONVAGJPW-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|