C29H32N4OS — CID 125079798
(4S,5R)-1-(4-ethoxyphenyl)-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione (PubChem CID 125079798) has the molecular formula C29H32N4OS and a molecular weight of 484.67 g/mol. Its IUPAC name is (4S,5R)-1-(4-ethoxyphenyl)-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione.
| Compound Name | (4S,5R)-1-(4-ethoxyphenyl)-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 125079798 |
| Molecular Formula | C29H32N4OS |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (4S,5R)-1-(4-ethoxyphenyl)-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione |
| SMILES | CCOc1ccc(N2C(=S)N[C@H](c3ccccn3)[C@H]2c2ccc3c(c2)C(C)=CC(C)(C)N3C)cc1 |
| InChI | InChI=1S/C29H32N4OS/c1-6-34-22-13-11-21(12-14-22)33-27(26(31-28(33)35)24-9-7-8-16-30-24)20-10-15-25-23(17-20)19(2)18-29(3,4)32(25)5/h7-18,26-27H,6H2,1-5H3,(H,31,35)/t26-,27-/m1/s1 |
| InChIKey | OUGJGGMCNHRKDD-KAYWLYCHSA-N |
| XLogP | 6.29 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|