C27H27ClN4S — CID 125080629
(4R,5S)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-phenyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125080629) has the molecular formula C27H27ClN4S and a molecular weight of 475.06 g/mol. Its IUPAC name is (4R,5S)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-phenyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-phenyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125080629 |
| Molecular Formula | C27H27ClN4S |
| Molecular Weight | 475.06 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (4R,5S)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-phenyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c([C@H]3[C@H](c4ccccn4)NC(=S)N3c3ccccc3)cc21 |
| InChI | InChI=1S/C27H27ClN4S/c1-17-16-27(2,3)31(4)23-15-21(28)20(14-19(17)23)25-24(22-12-8-9-13-29-22)30-26(33)32(25)18-10-6-5-7-11-18/h5-16,24-25H,1-4H3,(H,30,33)/t24-,25-/m0/s1 |
| InChIKey | RYVFFLDGBQGHAH-DQEYMECFSA-N |
| XLogP | 6.54 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.06 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|