C33H37Cl2N5S — CID 125081575
(4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125081575) has the molecular formula C33H37Cl2N5S and a molecular weight of 606.67 g/mol. Its IUPAC name is (4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125081575 |
| Molecular Formula | C33H37Cl2N5S |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | (4R,5S)-1-[3-chloro-4-(4-methylpiperidin-1-yl)phenyl]-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c([C@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(N4CCC(C)CC4)c(Cl)c3)cc21 |
| InChI | InChI=1S/C33H37Cl2N5S/c1-20-11-14-39(15-12-20)28-10-9-22(16-26(28)35)40-31(30(37-32(40)41)27-8-6-7-13-36-27)24-17-23-21(2)19-33(3,4)38(5)29(23)18-25(24)34/h6-10,13,16-20,30-31H,11-12,14-15H2,1-5H3,(H,37,41)/t30-,31-/m0/s1 |
| InChIKey | YFMZJLXKJZGVNP-CONSDPRKSA-N |
| XLogP | 8.43 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|