C28H28BrClN4S — CID 100504909
(4R,5S)-1-(4-bromo-3-methylphenyl)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100504909) has the molecular formula C28H28BrClN4S and a molecular weight of 567.98 g/mol. Its IUPAC name is (4R,5S)-1-(4-bromo-3-methylphenyl)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(4-bromo-3-methylphenyl)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100504909 |
| Molecular Formula | C28H28BrClN4S |
| Molecular Weight | 567.98 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | (4R,5S)-1-(4-bromo-3-methylphenyl)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c([C@H]3[C@H](c4ccccn4)NC(=S)N3c3ccc(Br)c(C)c3)cc21 |
| InChI | InChI=1S/C28H28BrClN4S/c1-16-12-18(9-10-21(16)29)34-26(25(32-27(34)35)23-8-6-7-11-31-23)20-13-19-17(2)15-28(3,4)33(5)24(19)14-22(20)30/h6-15,25-26H,1-5H3,(H,32,35)/t25-,26-/m0/s1 |
| InChIKey | PADIZXVDRCWAAN-UIOOFZCWSA-N |
| XLogP | 7.61 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.98 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|