C24H29ClN4S — CID 125055209
(4R,5R)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-propyl-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125055209) has the molecular formula C24H29ClN4S and a molecular weight of 441.04 g/mol. Its IUPAC name is (4R,5R)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-propyl-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-propyl-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125055209 |
| Molecular Formula | C24H29ClN4S |
| Molecular Weight | 441.04 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (4R,5R)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-propyl-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCCN1C(=S)N[C@@H](c2ccccn2)[C@H]1c1cc2c(cc1Cl)N(C)C(C)(C)C=C2C |
| InChI | InChI=1S/C24H29ClN4S/c1-6-11-29-22(21(27-23(29)30)19-9-7-8-10-26-19)17-12-16-15(2)14-24(3,4)28(5)20(16)13-18(17)25/h7-10,12-14,21-22H,6,11H2,1-5H3,(H,27,30)/t21-,22+/m0/s1 |
| InChIKey | OVKVSWIAFFBOTG-FCHUYYIVSA-N |
| XLogP | 5.75 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.04 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|