C34H33ClN4OS — CID 133183516
5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-[4-(2-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133183516) has the molecular formula C34H33ClN4OS and a molecular weight of 581.19 g/mol. Its IUPAC name is 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-[4-(2-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-[4-(2-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133183516 |
| Molecular Formula | C34H33ClN4OS |
| Molecular Weight | 581.19 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-[4-(2-methylphenoxy)phenyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(C3C(c4ccccn4)NC(=S)N3c3ccc(Oc4ccccc4C)cc3)cc21 |
| InChI | InChI=1S/C34H33ClN4OS/c1-21-10-6-7-12-30(21)40-24-15-13-23(14-16-24)39-32(31(37-33(39)41)28-11-8-9-17-36-28)26-18-25-22(2)20-34(3,4)38(5)29(25)19-27(26)35/h6-20,31-32H,1-5H3,(H,37,41) |
| InChIKey | LVOPEWVOQNFMHT-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.19 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|