C25H31ClN4S — CID 125054758
(4S,5S)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(2-methylpropyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125054758) has the molecular formula C25H31ClN4S and a molecular weight of 455.07 g/mol. Its IUPAC name is (4S,5S)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(2-methylpropyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(2-methylpropyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125054758 |
| Molecular Formula | C25H31ClN4S |
| Molecular Weight | 455.07 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (4S,5S)-5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(2-methylpropyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c([C@H]3[C@@H](c4ccccn4)NC(=S)N3CC(C)C)cc21 |
| InChI | InChI=1S/C25H31ClN4S/c1-15(2)14-30-23(22(28-24(30)31)20-9-7-8-10-27-20)18-11-17-16(3)13-25(4,5)29(6)21(17)12-19(18)26/h7-13,15,22-23H,14H2,1-6H3,(H,28,31)/t22-,23+/m1/s1 |
| InChIKey | NMDWFJLAMXJMRM-PKTZIBPZSA-N |
| XLogP | 6.00 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.07 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|