C24H29ClN4OS — CID 133182047
5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133182047) has the molecular formula C24H29ClN4OS and a molecular weight of 457.04 g/mol. Its IUPAC name is 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133182047 |
| Molecular Formula | C24H29ClN4OS |
| Molecular Weight | 457.04 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(3-hydroxypropyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(C3C(c4ccccn4)NC(=S)N3CCCO)cc21 |
| InChI | InChI=1S/C24H29ClN4OS/c1-15-14-24(2,3)28(4)20-13-18(25)17(12-16(15)20)22-21(19-8-5-6-9-26-19)27-23(31)29(22)10-7-11-30/h5-6,8-9,12-14,21-22,30H,7,10-11H2,1-4H3,(H,27,31) |
| InChIKey | DIRIQURCDQDAML-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.04 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|