C25H32ClN5S — CID 133223375
5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-[2-(dimethylamino)ethyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133223375) has the molecular formula C25H32ClN5S and a molecular weight of 470.09 g/mol. Its IUPAC name is 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-[2-(dimethylamino)ethyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-[2-(dimethylamino)ethyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133223375 |
| Molecular Formula | C25H32ClN5S |
| Molecular Weight | 470.09 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-[2-(dimethylamino)ethyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CC1=CC(C)(C)N(C)c2cc(Cl)c(C3C(c4ccccn4)NC(=S)N3CCN(C)C)cc21 |
| InChI | InChI=1S/C25H32ClN5S/c1-16-15-25(2,3)30(6)21-14-19(26)18(13-17(16)21)23-22(20-9-7-8-10-27-20)28-24(32)31(23)12-11-29(4)5/h7-10,13-15,22-23H,11-12H2,1-6H3,(H,28,32) |
| InChIKey | RDILUQOAZKOMTE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.09 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|