C29H31ClN4OS — CID 133156122
5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133156122) has the molecular formula C29H31ClN4OS and a molecular weight of 519.11 g/mol. Its IUPAC name is 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133156122 |
| Molecular Formula | C29H31ClN4OS |
| Molecular Weight | 519.11 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 5-(7-chloro-1,2,2,4-tetramethylquinolin-6-yl)-1-(4-ethoxyphenyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | CCOc1ccc(N2C(=S)NC(c3ccccn3)C2c2cc3c(cc2Cl)N(C)C(C)(C)C=C3C)cc1 |
| InChI | InChI=1S/C29H31ClN4OS/c1-6-35-20-12-10-19(11-13-20)34-27(26(32-28(34)36)24-9-7-8-14-31-24)22-15-21-18(2)17-29(3,4)33(5)25(21)16-23(22)30/h7-17,26-27H,6H2,1-5H3,(H,32,36) |
| InChIKey | DHFYIGUXNSEDNJ-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.11 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|