C26H32N4OS — CID 125080594
(4R,5R)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione (PubChem CID 125080594) has the molecular formula C26H32N4OS and a molecular weight of 448.64 g/mol. Its IUPAC name is (4R,5R)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione.
| Compound Name | (4R,5R)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 125080594 |
| Molecular Formula | C26H32N4OS |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (4R,5R)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-yl-5-(1,2,2,4-tetramethylquinolin-6-yl)imidazolidine-2-thione |
| SMILES | CC1=CC(C)(C)N(C)c2ccc([C@@H]3[C@H](c4ccccn4)NC(=S)N3C[C@H]3CCCO3)cc21 |
| InChI | InChI=1S/C26H32N4OS/c1-17-15-26(2,3)29(4)22-11-10-18(14-20(17)22)24-23(21-9-5-6-12-27-21)28-25(32)30(24)16-19-8-7-13-31-19/h5-6,9-12,14-15,19,23-24H,7-8,13,16H2,1-4H3,(H,28,32)/t19-,23+,24-/m1/s1 |
| InChIKey | RROLVNUBDYGXOQ-VEXUSMLFSA-N |
| XLogP | 4.86 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|