C18H21N3OS2 — CID 125078458
(4R,5S)-5-(5-methylthiophen-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125078458) has the molecular formula C18H21N3OS2 and a molecular weight of 359.52 g/mol. Its IUPAC name is (4R,5S)-5-(5-methylthiophen-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5S)-5-(5-methylthiophen-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125078458 |
| Molecular Formula | C18H21N3OS2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (4R,5S)-5-(5-methylthiophen-2-yl)-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1ccc([C@@H]2[C@H](c3ccccn3)NC(=S)N2C[C@H]2CCCO2)s1 |
| InChI | InChI=1S/C18H21N3OS2/c1-12-7-8-15(24-12)17-16(14-6-2-3-9-19-14)20-18(23)21(17)11-13-5-4-10-22-13/h2-3,6-9,13,16-17H,4-5,10-11H2,1H3,(H,20,23)/t13-,16+,17-/m1/s1 |
| InChIKey | IEWRXRPGSOPLCA-XOKHGSTOSA-N |
| XLogP | 3.60 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|