C23H24N4OS — CID 125081607
(4S,5R)-1-[[(2R)-oxolan-2-yl]methyl]-5-(1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125081607) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is (4S,5R)-1-[[(2R)-oxolan-2-yl]methyl]-5-(1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5R)-1-[[(2R)-oxolan-2-yl]methyl]-5-(1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125081607 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (4S,5R)-1-[[(2R)-oxolan-2-yl]methyl]-5-(1-phenylpyrrol-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@H](c2ccccn2)[C@H](c2cccn2-c2ccccc2)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C23H24N4OS/c29-23-25-21(19-11-4-5-13-24-19)22(27(23)16-18-10-7-15-28-18)20-12-6-14-26(20)17-8-2-1-3-9-17/h1-6,8-9,11-14,18,21-22H,7,10,15-16H2,(H,25,29)/t18-,21-,22+/m1/s1 |
| InChIKey | YYQJVBZHQIJQAM-QIJUGHKUSA-N |
| XLogP | 4.02 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|