C23H23ClN4OS — CID 125077345
(4S,5S)-5-[1-(3-chlorophenyl)pyrrol-2-yl]-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125077345) has the molecular formula C23H23ClN4OS and a molecular weight of 438.98 g/mol. Its IUPAC name is (4S,5S)-5-[1-(3-chlorophenyl)pyrrol-2-yl]-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-5-[1-(3-chlorophenyl)pyrrol-2-yl]-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125077345 |
| Molecular Formula | C23H23ClN4OS |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | (4S,5S)-5-[1-(3-chlorophenyl)pyrrol-2-yl]-1-[[(2R)-oxolan-2-yl]methyl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@H](c2ccccn2)[C@@H](c2cccn2-c2cccc(Cl)c2)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C23H23ClN4OS/c24-16-6-3-7-17(14-16)27-12-4-10-20(27)22-21(19-9-1-2-11-25-19)26-23(30)28(22)15-18-8-5-13-29-18/h1-4,6-7,9-12,14,18,21-22H,5,8,13,15H2,(H,26,30)/t18-,21-,22-/m1/s1 |
| InChIKey | FLLKRGSUBZHCOZ-STZQEDGTSA-N |
| XLogP | 4.68 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|