C24H26ClN5OS — CID 133222891
5-[1-(3-chlorophenyl)pyrrol-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222891) has the molecular formula C24H26ClN5OS and a molecular weight of 468.03 g/mol. Its IUPAC name is 5-[1-(3-chlorophenyl)pyrrol-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(3-chlorophenyl)pyrrol-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222891 |
| Molecular Formula | C24H26ClN5OS |
| Molecular Weight | 468.03 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 5-[1-(3-chlorophenyl)pyrrol-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1NC(c2ccccn2)C(c2cccn2-c2cccc(Cl)c2)N1CCN1CCOCC1 |
| InChI | InChI=1S/C24H26ClN5OS/c25-18-5-3-6-19(17-18)29-10-4-8-21(29)23-22(20-7-1-2-9-26-20)27-24(32)30(23)12-11-28-13-15-31-16-14-28/h1-10,17,22-23H,11-16H2,(H,27,32) |
| InChIKey | QZDKXYRHDYOXPT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.03 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|