C25H29N5O2S — CID 133222890
5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133222890) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is 5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133222890 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 5-[1-(2-methoxyphenyl)pyrrol-2-yl]-1-(2-morpholin-4-ylethyl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccccc1-n1cccc1C1C(c2ccccn2)NC(=S)N1CCN1CCOCC1 |
| InChI | InChI=1S/C25H29N5O2S/c1-31-22-10-3-2-8-20(22)29-12-6-9-21(29)24-23(19-7-4-5-11-26-19)27-25(33)30(24)14-13-28-15-17-32-18-16-28/h2-12,23-24H,13-18H2,1H3,(H,27,33) |
| InChIKey | OMNRXAWMCFKLTC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|