C23H24N4O3S — CID 133155625
methyl 3-[5-[1-(2-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate (PubChem CID 133155625) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is methyl 3-[5-[1-(2-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate.
| Compound Name | methyl 3-[5-[1-(2-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 133155625 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | methyl 3-[5-[1-(2-methoxyphenyl)pyrrol-2-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate |
| SMILES | COC(=O)CCN1C(=S)NC(c2ccccn2)C1c1cccn1-c1ccccc1OC |
| InChI | InChI=1S/C23H24N4O3S/c1-29-19-11-4-3-9-17(19)26-14-7-10-18(26)22-21(16-8-5-6-13-24-16)25-23(31)27(22)15-12-20(28)30-2/h3-11,13-14,21-22H,12,15H2,1-2H3,(H,25,31) |
| InChIKey | XQSVVZRKIBLREC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|