C19H24N4O2S — CID 133155789
methyl 4-[5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate (PubChem CID 133155789) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is methyl 4-[5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate.
| Compound Name | methyl 4-[5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 133155789 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | methyl 4-[5-(1,5-dimethylpyrrol-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1C(=S)NC(c2ccccn2)C1c1ccc(C)n1C |
| InChI | InChI=1S/C19H24N4O2S/c1-13-9-10-15(22(13)2)18-17(14-7-4-5-11-20-14)21-19(26)23(18)12-6-8-16(24)25-3/h4-5,7,9-11,17-18H,6,8,12H2,1-3H3,(H,21,26) |
| InChIKey | GPATUNJLKCTKDA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|