C17H19N3O2S2 — CID 133155601
methyl 3-[5-(3-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate (PubChem CID 133155601) has the molecular formula C17H19N3O2S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is methyl 3-[5-(3-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate.
| Compound Name | methyl 3-[5-(3-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 133155601 |
| Molecular Formula | C17H19N3O2S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | methyl 3-[5-(3-methylthiophen-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate |
| SMILES | COC(=O)CCN1C(=S)NC(c2ccccn2)C1c1sccc1C |
| InChI | InChI=1S/C17H19N3O2S2/c1-11-7-10-24-16(11)15-14(12-5-3-4-8-18-12)19-17(23)20(15)9-6-13(21)22-2/h3-5,7-8,10,14-15H,6,9H2,1-2H3,(H,19,23) |
| InChIKey | ALVNEXYGENJBHC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|