C27H32N4O2S — CID 133155683
methyl 3-[5-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate (PubChem CID 133155683) has the molecular formula C27H32N4O2S and a molecular weight of 476.65 g/mol. Its IUPAC name is methyl 3-[5-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate.
| Compound Name | methyl 3-[5-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate |
|---|---|
| PubChem CID | 133155683 |
| Molecular Formula | C27H32N4O2S |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | methyl 3-[5-[2,5-dimethyl-1-(2,4,6-trimethylphenyl)pyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanoate |
| SMILES | COC(=O)CCN1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2c(C)cc(C)cc2C)c1C |
| InChI | InChI=1S/C27H32N4O2S/c1-16-13-17(2)25(18(3)14-16)31-19(4)15-21(20(31)5)26-24(22-9-7-8-11-28-22)29-27(34)30(26)12-10-23(32)33-6/h7-9,11,13-15,24,26H,10,12H2,1-6H3,(H,29,34) |
| InChIKey | USZDVRDSODXGIH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|