C25H27ClN4O3S — CID 133155799
methyl 4-[5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate (PubChem CID 133155799) has the molecular formula C25H27ClN4O3S and a molecular weight of 499.04 g/mol. Its IUPAC name is methyl 4-[5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate.
| Compound Name | methyl 4-[5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 133155799 |
| Molecular Formula | C25H27ClN4O3S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | methyl 4-[5-[1-(5-chloro-2-hydroxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2cc(Cl)ccc2O)c1C |
| InChI | InChI=1S/C25H27ClN4O3S/c1-15-13-18(16(2)30(15)20-14-17(26)9-10-21(20)31)24-23(19-7-4-5-11-27-19)28-25(34)29(24)12-6-8-22(32)33-3/h4-5,7,9-11,13-14,23-24,31H,6,8,12H2,1-3H3,(H,28,34) |
| InChIKey | WFWKBNJAQYENGO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|