C26H29N5O5S — CID 133155853
methyl 4-[5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate (PubChem CID 133155853) has the molecular formula C26H29N5O5S and a molecular weight of 523.62 g/mol. Its IUPAC name is methyl 4-[5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate.
| Compound Name | methyl 4-[5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 133155853 |
| Molecular Formula | C26H29N5O5S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | methyl 4-[5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]butanoate |
| SMILES | COC(=O)CCCN1C(=S)NC(c2ccccn2)C1c1cc(C)n(-c2ccc(OC)cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C26H29N5O5S/c1-16-14-19(17(2)30(16)21-11-10-18(35-3)15-22(21)31(33)34)25-24(20-8-5-6-12-27-20)28-26(37)29(25)13-7-9-23(32)36-4/h5-6,8,10-12,14-15,24-25H,7,9,13H2,1-4H3,(H,28,37) |
| InChIKey | XABWLWUAEUUWMU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 111.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|