C35H32N6O5S — CID 100537749
N-[4-[(4S,5S)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide (PubChem CID 100537749) has the molecular formula C35H32N6O5S and a molecular weight of 648.75 g/mol. Its IUPAC name is N-[4-[(4S,5S)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[(4S,5S)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 100537749 |
| Molecular Formula | C35H32N6O5S |
| Molecular Weight | 648.75 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | N-[4-[(4S,5S)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
| SMILES | COc1ccc(-n2c(C)cc([C@H]3[C@@H](c4ccccn4)NC(=S)N3c3ccc(NC(=O)COc4ccccc4)cc3)c2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C35H32N6O5S/c1-22-19-28(23(2)39(22)30-17-16-27(45-3)20-31(30)41(43)44)34-33(29-11-7-8-18-36-29)38-35(47)40(34)25-14-12-24(13-15-25)37-32(42)21-46-26-9-5-4-6-10-26/h4-20,33-34H,21H2,1-3H3,(H,37,42)(H,38,47)/t33-,34+/m1/s1 |
| InChIKey | VFWCRCGEPQFYLV-NOCHOARKSA-N |
| XLogP | 6.60 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|