C30H30N6O4S — CID 133208523
3-[5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide (PubChem CID 133208523) has the molecular formula C30H30N6O4S and a molecular weight of 570.68 g/mol. Its IUPAC name is 3-[5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide.
| Compound Name | 3-[5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 133208523 |
| Molecular Formula | C30H30N6O4S |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | 3-[5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylpropanamide |
| SMILES | COc1ccc(-n2c(C)cc(C3C(c4ccccn4)NC(=S)N3CCC(=O)Nc3ccccc3)c2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H30N6O4S/c1-19-17-23(20(2)35(19)25-13-12-22(40-3)18-26(25)36(38)39)29-28(24-11-7-8-15-31-24)33-30(41)34(29)16-14-27(37)32-21-9-5-4-6-10-21/h4-13,15,17-18,28-29H,14,16H2,1-3H3,(H,32,37)(H,33,41) |
| InChIKey | HYPIJORWLWIRIR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|