C29H28N6O4S — CID 100660025
2-[(4R,5R)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide (PubChem CID 100660025) has the molecular formula C29H28N6O4S and a molecular weight of 556.65 g/mol. Its IUPAC name is 2-[(4R,5R)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[(4R,5R)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 100660025 |
| Molecular Formula | C29H28N6O4S |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 2-[(4R,5R)-5-[1-(4-methoxy-2-nitrophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-phenylacetamide |
| SMILES | COc1ccc(-n2c(C)cc([C@@H]3[C@H](c4ccccn4)NC(=S)N3CC(=O)Nc3ccccc3)c2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H28N6O4S/c1-18-15-22(19(2)34(18)24-13-12-21(39-3)16-25(24)35(37)38)28-27(23-11-7-8-14-30-23)32-29(40)33(28)17-26(36)31-20-9-5-4-6-10-20/h4-16,27-28H,17H2,1-3H3,(H,31,36)(H,32,40)/t27-,28+/m0/s1 |
| InChIKey | ZNYJKTFHGDIXNZ-WUFINQPMSA-N |
| XLogP | 5.02 |
| TPSA | 114.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|