C35H32ClN5O2S — CID 100537797
N-[4-[(4R,5R)-5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide (PubChem CID 100537797) has the molecular formula C35H32ClN5O2S and a molecular weight of 622.19 g/mol. Its IUPAC name is N-[4-[(4R,5R)-5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[(4R,5R)-5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 100537797 |
| Molecular Formula | C35H32ClN5O2S |
| Molecular Weight | 622.19 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | N-[4-[(4R,5R)-5-[1-(5-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
| SMILES | Cc1ccc(Cl)cc1-n1c(C)cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2c2ccc(NC(=O)COc3ccccc3)cc2)c1C |
| InChI | InChI=1S/C35H32ClN5O2S/c1-22-12-13-25(36)20-31(22)40-23(2)19-29(24(40)3)34-33(30-11-7-8-18-37-30)39-35(44)41(34)27-16-14-26(15-17-27)38-32(42)21-43-28-9-5-4-6-10-28/h4-20,33-34H,21H2,1-3H3,(H,38,42)(H,39,44)/t33-,34+/m0/s1 |
| InChIKey | MOOHWBAEHMMJCE-SZAHLOSFSA-N |
| XLogP | 7.65 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.19 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|