C36H36N6O2S — CID 133242276
N-[4-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide (PubChem CID 133242276) has the molecular formula C36H36N6O2S and a molecular weight of 616.79 g/mol. Its IUPAC name is N-[4-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 133242276 |
| Molecular Formula | C36H36N6O2S |
| Molecular Weight | 616.79 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | N-[4-[5-[1-[4-(dimethylamino)phenyl]-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]phenyl]-2-phenoxyacetamide |
| SMILES | Cc1cc(C2C(c3ccccn3)NC(=S)N2c2ccc(NC(=O)COc3ccccc3)cc2)c(C)n1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C36H36N6O2S/c1-24-22-31(25(2)41(24)28-19-17-27(18-20-28)40(3)4)35-34(32-12-8-9-21-37-32)39-36(45)42(35)29-15-13-26(14-16-29)38-33(43)23-44-30-10-6-5-7-11-30/h5-22,34-35H,23H2,1-4H3,(H,38,43)(H,39,45) |
| InChIKey | RROSRKYGIGIANB-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.79 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|