C30H32ClN5OS — CID 133242112
1-(3-anilinopropyl)-5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 133242112) has the molecular formula C30H32ClN5OS and a molecular weight of 546.14 g/mol. Its IUPAC name is 1-(3-anilinopropyl)-5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | 1-(3-anilinopropyl)-5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 133242112 |
| Molecular Formula | C30H32ClN5OS |
| Molecular Weight | 546.14 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 1-(3-anilinopropyl)-5-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | COc1ccc(Cl)cc1-n1c(C)cc(C2C(c3ccccn3)NC(=S)N2CCCNc2ccccc2)c1C |
| InChI | InChI=1S/C30H32ClN5OS/c1-20-18-24(21(2)36(20)26-19-22(31)13-14-27(26)37-3)29-28(25-12-7-8-15-33-25)34-30(38)35(29)17-9-16-32-23-10-5-4-6-11-23/h4-8,10-15,18-19,28-29,32H,9,16-17H2,1-3H3,(H,34,38) |
| InChIKey | YRJPXTOLPCPSBA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.14 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|