C29H29Cl2N5S — CID 100531187
(4R,5R)-1-(3-anilinopropyl)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 100531187) has the molecular formula C29H29Cl2N5S and a molecular weight of 550.56 g/mol. Its IUPAC name is (4R,5R)-1-(3-anilinopropyl)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4R,5R)-1-(3-anilinopropyl)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 100531187 |
| Molecular Formula | C29H29Cl2N5S |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | (4R,5R)-1-(3-anilinopropyl)-5-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | Cc1cc([C@@H]2[C@H](c3ccccn3)NC(=S)N2CCCNc2ccccc2)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C29H29Cl2N5S/c1-19-18-22(20(2)36(19)25-14-8-12-23(30)26(25)31)28-27(24-13-6-7-15-33-24)34-29(37)35(28)17-9-16-32-21-10-4-3-5-11-21/h3-8,10-15,18,27-28,32H,9,16-17H2,1-2H3,(H,34,37)/t27-,28+/m0/s1 |
| InChIKey | SNTVLUXXIPCMDY-WUFINQPMSA-N |
| XLogP | 7.27 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|