C24H29N5S — CID 100530011
(4R,5S)-1-(3-anilinopropyl)-4-pyridin-2-yl-5-(1,2,5-trimethylpyrrol-3-yl)imidazolidine-2-thione (PubChem CID 100530011) has the molecular formula C24H29N5S and a molecular weight of 419.60 g/mol. Its IUPAC name is (4R,5S)-1-(3-anilinopropyl)-4-pyridin-2-yl-5-(1,2,5-trimethylpyrrol-3-yl)imidazolidine-2-thione.
| Compound Name | (4R,5S)-1-(3-anilinopropyl)-4-pyridin-2-yl-5-(1,2,5-trimethylpyrrol-3-yl)imidazolidine-2-thione |
|---|---|
| PubChem CID | 100530011 |
| Molecular Formula | C24H29N5S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (4R,5S)-1-(3-anilinopropyl)-4-pyridin-2-yl-5-(1,2,5-trimethylpyrrol-3-yl)imidazolidine-2-thione |
| SMILES | Cc1cc([C@H]2[C@H](c3ccccn3)NC(=S)N2CCCNc2ccccc2)c(C)n1C |
| InChI | InChI=1S/C24H29N5S/c1-17-16-20(18(2)28(17)3)23-22(21-12-7-8-13-26-21)27-24(30)29(23)15-9-14-25-19-10-5-4-6-11-19/h4-8,10-13,16,22-23,25H,9,14-15H2,1-3H3,(H,27,30)/t22-,23-/m0/s1 |
| InChIKey | IHFWBWDPSSIJCG-GOTSBHOMSA-N |
| XLogP | 4.51 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|